C13H14F2N2O — CID 126695840
2,6-difluoro-4-(piperidin-4-ylmethoxy)benzonitrile (PubChem CID 126695840) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is 2,6-difluoro-4-(piperidin-4-ylmethoxy)benzonitrile.
| Compound Name | 2,6-difluoro-4-(piperidin-4-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 126695840 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2,6-difluoro-4-(piperidin-4-ylmethoxy)benzonitrile |
| SMILES | N#Cc1c(F)cc(OCC2CCNCC2)cc1F |
| InChI | InChI=1S/C13H14F2N2O/c14-12-5-10(6-13(15)11(12)7-16)18-8-9-1-3-17-4-2-9/h5-6,9,17H,1-4,8H2 |
| InChIKey | HUXQXMHPXDTXHV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |