C22H20F2N4O2 — CID 126697869
7-(4-amino-2,5-difluorophenyl)-2-(2-aminoethyl)-5-cyclopropyl-6-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one (PubChem CID 126697869) has the molecular formula C22H20F2N4O2 and a molecular weight of 410.42 g/mol. Its IUPAC name is 7-(4-amino-2,5-difluorophenyl)-2-(2-aminoethyl)-5-cyclopropyl-6-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one.
| Compound Name | 7-(4-amino-2,5-difluorophenyl)-2-(2-aminoethyl)-5-cyclopropyl-6-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
|---|---|
| PubChem CID | 126697869 |
| Molecular Formula | C22H20F2N4O2 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 7-(4-amino-2,5-difluorophenyl)-2-(2-aminoethyl)-5-cyclopropyl-6-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
| SMILES | Cc1c(-c2cc(F)c(N)cc2F)ccc2c3oc(CCN)nc3c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C22H20F2N4O2/c1-10-12(14-8-16(24)17(26)9-15(14)23)4-5-13-20(10)28(11-2-3-11)22(29)19-21(13)30-18(27-19)6-7-25/h4-5,8-9,11H,2-3,6-7,25-26H2,1H3 |
| InChIKey | CNOAYSPFBWGRAW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|