C20H19F2N3O2 — CID 123192474
3-amino-7-(4-amino-2,5-difluorophenyl)-1-cyclopropyl-4-methoxy-8-methylquinolin-2-one (PubChem CID 123192474) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-amino-7-(4-amino-2,5-difluorophenyl)-1-cyclopropyl-4-methoxy-8-methylquinolin-2-one.
| Compound Name | 3-amino-7-(4-amino-2,5-difluorophenyl)-1-cyclopropyl-4-methoxy-8-methylquinolin-2-one |
|---|---|
| PubChem CID | 123192474 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-amino-7-(4-amino-2,5-difluorophenyl)-1-cyclopropyl-4-methoxy-8-methylquinolin-2-one |
| SMILES | COc1c(N)c(=O)n(C2CC2)c2c(C)c(-c3cc(F)c(N)cc3F)ccc12 |
| InChI | InChI=1S/C20H19F2N3O2/c1-9-11(13-7-15(22)16(23)8-14(13)21)5-6-12-18(9)25(10-3-4-10)20(26)17(24)19(12)27-2/h5-8,10H,3-4,23-24H2,1-2H3 |
| InChIKey | QNKKSTGIFDISAX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|