C12H10F2N2O — CID 67938788
5-amino-1-cyclopropyl-6,8-difluoroquinolin-2-one (PubChem CID 67938788) has the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-6,8-difluoroquinolin-2-one.
| Compound Name | 5-amino-1-cyclopropyl-6,8-difluoroquinolin-2-one |
|---|---|
| PubChem CID | 67938788 |
| Molecular Formula | C12H10F2N2O |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-amino-1-cyclopropyl-6,8-difluoroquinolin-2-one |
| SMILES | Nc1c(F)cc(F)c2c1ccc(=O)n2C1CC1 |
| InChI | InChI=1S/C12H10F2N2O/c13-8-5-9(14)12-7(11(8)15)3-4-10(17)16(12)6-1-2-6/h3-6H,1-2,15H2 |
| InChIKey | LEUJRUNDNHGOOJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|