C20H15F2N3O2 — CID 126717286
7-(4-amino-3,5-difluorophenyl)-5-cyclopropyl-6-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one (PubChem CID 126717286) has the molecular formula C20H15F2N3O2 and a molecular weight of 367.36 g/mol. Its IUPAC name is 7-(4-amino-3,5-difluorophenyl)-5-cyclopropyl-6-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one.
| Compound Name | 7-(4-amino-3,5-difluorophenyl)-5-cyclopropyl-6-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
|---|---|
| PubChem CID | 126717286 |
| Molecular Formula | C20H15F2N3O2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 7-(4-amino-3,5-difluorophenyl)-5-cyclopropyl-6-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
| SMILES | Cc1c(-c2cc(F)c(N)c(F)c2)ccc2c3ocnc3c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C20H15F2N3O2/c1-9-12(10-6-14(21)16(23)15(22)7-10)4-5-13-18(9)25(11-2-3-11)20(26)17-19(13)27-8-24-17/h4-8,11H,2-3,23H2,1H3 |
| InChIKey | YUHGMHCBWYSEMA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|