C31H25N5O3S — CID 126698353
5-amino-N-[2-[(1R,12S)-3-methyl-7-oxo-5-thia-10-azatetracyclo[7.5.0.01,12.02,6]tetradeca-2(6),3,8-triene-10-carbonyl]-1H-indol-5-yl]-1H-indole-2-carboxamide (PubChem CID 126698353) has the molecular formula C31H25N5O3S and a molecular weight of 547.64 g/mol. Its IUPAC name is 5-amino-N-[2-[(1R,12S)-3-methyl-7-oxo-5-thia-10-azatetracyclo[7.5.0.01,12.02,6]tetradeca-2(6),3,8-triene-10-carbonyl]-1H-indol-5-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-amino-N-[2-[(1R,12S)-3-methyl-7-oxo-5-thia-10-azatetracyclo[7.5.0.01,12.02,6]tetradeca-2(6),3,8-triene-10-carbonyl]-1H-indol-5-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 126698353 |
| Molecular Formula | C31H25N5O3S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 5-amino-N-[2-[(1R,12S)-3-methyl-7-oxo-5-thia-10-azatetracyclo[7.5.0.01,12.02,6]tetradeca-2(6),3,8-triene-10-carbonyl]-1H-indol-5-yl]-1H-indole-2-carboxamide |
| SMILES | Cc1csc2c1[C@@]13CC[C@@H]1CN(C(=O)c1cc4cc(NC(=O)c5cc6cc(N)ccc6[nH]5)ccc4[nH]1)C3=CC2=O |
| InChI | InChI=1S/C31H25N5O3S/c1-15-14-40-28-25(37)12-26-31(27(15)28)7-6-18(31)13-36(26)30(39)24-11-17-9-20(3-5-22(17)35-24)33-29(38)23-10-16-8-19(32)2-4-21(16)34-23/h2-5,8-12,14,18,34-35H,6-7,13,32H2,1H3,(H,33,38)/t18-,31+/m1/s1 |
| InChIKey | JPJUMLLQBNXLAS-OKXSDPAFSA-N |
| XLogP | 5.74 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|