C35H26N4O10 — CID 100930826
dimethyl (1R,12S)-10-[5-[(6-methoxycarbonyl-1-benzofuran-2-carbonyl)amino]-1H-indole-2-carbonyl]-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3,4-dicarboxylate (PubChem CID 100930826) has the molecular formula C35H26N4O10 and a molecular weight of 662.61 g/mol. Its IUPAC name is dimethyl (1R,12S)-10-[5-[(6-methoxycarbonyl-1-benzofuran-2-carbonyl)amino]-1H-indole-2-carbonyl]-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3,4-dicarboxylate.
| Compound Name | dimethyl (1R,12S)-10-[5-[(6-methoxycarbonyl-1-benzofuran-2-carbonyl)amino]-1H-indole-2-carbonyl]-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 100930826 |
| Molecular Formula | C35H26N4O10 |
| Molecular Weight | 662.61 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | dimethyl (1R,12S)-10-[5-[(6-methoxycarbonyl-1-benzofuran-2-carbonyl)amino]-1H-indole-2-carbonyl]-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3,4-dicarboxylate |
| SMILES | COC(=O)c1ccc2cc(C(=O)Nc3ccc4[nH]c(C(=O)N5C[C@H]6C[C@@]67C5=CC(=O)c5[nH]c(C(=O)OC)c(C(=O)OC)c57)cc4c3)oc2c1 |
| InChI | InChI=1S/C35H26N4O10/c1-46-32(43)16-5-4-15-10-24(49-23(15)11-16)30(41)36-19-6-7-20-17(8-19)9-21(37-20)31(42)39-14-18-13-35(18)25(39)12-22(40)28-27(35)26(33(44)47-2)29(38-28)34(45)48-3/h4-12,18,37-38H,13-14H2,1-3H3,(H,36,41)/t18-,35+/m1/s1 |
| InChIKey | QFQHPHCYTXIUSN-CDAMAVENSA-N |
| XLogP | 4.35 |
| TPSA | 190.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|