C35H31N5O5S — CID 154036947
[1-tert-butyl-2-[[2-[(1R,12S)-3-methyl-7-oxo-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carbonyl]-1H-indol-5-yl]carbamoyl]indol-5-yl] carbamate (PubChem CID 154036947) has the molecular formula C35H31N5O5S and a molecular weight of 633.73 g/mol. Its IUPAC name is [1-tert-butyl-2-[[2-[(1R,12S)-3-methyl-7-oxo-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carbonyl]-1H-indol-5-yl]carbamoyl]indol-5-yl] carbamate.
| Compound Name | [1-tert-butyl-2-[[2-[(1R,12S)-3-methyl-7-oxo-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carbonyl]-1H-indol-5-yl]carbamoyl]indol-5-yl] carbamate |
|---|---|
| PubChem CID | 154036947 |
| Molecular Formula | C35H31N5O5S |
| Molecular Weight | 633.73 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | [1-tert-butyl-2-[[2-[(1R,12S)-3-methyl-7-oxo-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carbonyl]-1H-indol-5-yl]carbamoyl]indol-5-yl] carbamate |
| SMILES | Cc1csc2c1[C@@]13C[C@@H]1CN(C(=O)c1cc4cc(NC(=O)c5cc6cc(OC(N)=O)ccc6n5C(C)(C)C)ccc4[nH]1)C3=CC2=O |
| InChI | InChI=1S/C35H31N5O5S/c1-17-16-46-30-27(41)13-28-35(29(17)30)14-20(35)15-39(28)32(43)24-11-18-9-21(5-7-23(18)38-24)37-31(42)26-12-19-10-22(45-33(36)44)6-8-25(19)40(26)34(2,3)4/h5-13,16,20,38H,14-15H2,1-4H3,(H2,36,44)(H,37,42)/t20-,35+/m1/s1 |
| InChIKey | XRVVECUPUXCCOU-GOKJBEJGSA-N |
| XLogP | 6.45 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |