C19H24F3N3O2 — CID 126700360
N-butyl-3-tert-butyl-2-hydroxy-5-[3-(trifluoromethyl)pyrazol-1-yl]benzamide (PubChem CID 126700360) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-butyl-3-tert-butyl-2-hydroxy-5-[3-(trifluoromethyl)pyrazol-1-yl]benzamide.
| Compound Name | N-butyl-3-tert-butyl-2-hydroxy-5-[3-(trifluoromethyl)pyrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 126700360 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-butyl-3-tert-butyl-2-hydroxy-5-[3-(trifluoromethyl)pyrazol-1-yl]benzamide |
| SMILES | CCCCNC(=O)c1cc(-n2ccc(C(F)(F)F)n2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H24F3N3O2/c1-5-6-8-23-17(27)13-10-12(11-14(16(13)26)18(2,3)4)25-9-7-15(24-25)19(20,21)22/h7,9-11,26H,5-6,8H2,1-4H3,(H,23,27) |
| InChIKey | KEYCZIUGGNHXRF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|