C18H25N3O2 — CID 126701320
N-butyl-5-tert-butyl-2-hydroxy-3-pyrazol-1-ylbenzamide (PubChem CID 126701320) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-butyl-5-tert-butyl-2-hydroxy-3-pyrazol-1-ylbenzamide.
| Compound Name | N-butyl-5-tert-butyl-2-hydroxy-3-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 126701320 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-butyl-5-tert-butyl-2-hydroxy-3-pyrazol-1-ylbenzamide |
| SMILES | CCCCNC(=O)c1cc(C(C)(C)C)cc(-n2cccn2)c1O |
| InChI | InChI=1S/C18H25N3O2/c1-5-6-8-19-17(23)14-11-13(18(2,3)4)12-15(16(14)22)21-10-7-9-20-21/h7,9-12,22H,5-6,8H2,1-4H3,(H,19,23) |
| InChIKey | YYOOZZVGEBTNHZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|