C19H39NO — CID 126701387
N,2,2,3,3,5,5,7,7-nonamethyldecanamide (PubChem CID 126701387) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is N,2,2,3,3,5,5,7,7-nonamethyldecanamide.
| Compound Name | N,2,2,3,3,5,5,7,7-nonamethyldecanamide |
|---|---|
| PubChem CID | 126701387 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | N,2,2,3,3,5,5,7,7-nonamethyldecanamide |
| SMILES | CCCC(C)(C)CC(C)(C)CC(C)(C)C(C)(C)C(=O)NC |
| InChI | InChI=1S/C19H39NO/c1-11-12-16(2,3)13-17(4,5)14-18(6,7)19(8,9)15(21)20-10/h11-14H2,1-10H3,(H,20,21) |
| InChIKey | XZFMHZVVWPIZRQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |