C16H22N2O8 — CID 126702966
bis(4-amino-2,2-dimethyl-3,4-dioxobutyl) (E)-but-2-enedioate (PubChem CID 126702966) has the molecular formula C16H22N2O8 and a molecular weight of 370.36 g/mol. Its IUPAC name is bis(4-amino-2,2-dimethyl-3,4-dioxobutyl) (E)-but-2-enedioate.
| Compound Name | bis(4-amino-2,2-dimethyl-3,4-dioxobutyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126702966 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | bis(4-amino-2,2-dimethyl-3,4-dioxobutyl) (E)-but-2-enedioate |
| SMILES | CC(C)(COC(=O)/C=C/C(=O)OCC(C)(C)C(=O)C(N)=O)C(=O)C(N)=O |
| InChI | InChI=1S/C16H22N2O8/c1-15(2,11(21)13(17)23)7-25-9(19)5-6-10(20)26-8-16(3,4)12(22)14(18)24/h5-6H,7-8H2,1-4H3,(H2,17,23)(H2,18,24)/b6-5+ |
| InChIKey | LVINNKMTZFONBG-AATRIKPKSA-N |
| XLogP | -1.21 |
| TPSA | 172.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|