C26H38N2O8 — CID 126633300
bis(2,2-dimethyl-3,4-dioxo-4-piperidin-1-ylbutyl) (E)-but-2-enedioate (PubChem CID 126633300) has the molecular formula C26H38N2O8 and a molecular weight of 506.60 g/mol. Its IUPAC name is bis(2,2-dimethyl-3,4-dioxo-4-piperidin-1-ylbutyl) (E)-but-2-enedioate.
| Compound Name | bis(2,2-dimethyl-3,4-dioxo-4-piperidin-1-ylbutyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126633300 |
| Molecular Formula | C26H38N2O8 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | bis(2,2-dimethyl-3,4-dioxo-4-piperidin-1-ylbutyl) (E)-but-2-enedioate |
| SMILES | CC(C)(COC(=O)/C=C/C(=O)OCC(C)(C)C(=O)C(=O)N1CCCCC1)C(=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C26H38N2O8/c1-25(2,21(31)23(33)27-13-7-5-8-14-27)17-35-19(29)11-12-20(30)36-18-26(3,4)22(32)24(34)28-15-9-6-10-16-28/h11-12H,5-10,13-18H2,1-4H3/b12-11+ |
| InChIKey | FXKCHKVZVVVNQD-VAWYXSNFSA-N |
| XLogP | 1.84 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|