C18H27NO6 — CID 156718996
(2S)-1-[4-[(Z)-hex-2-enoyl]oxy-3,3-dimethyl-2-oxobutanoyl]piperidine-2-carboxylic acid (PubChem CID 156718996) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S)-1-[4-[(Z)-hex-2-enoyl]oxy-3,3-dimethyl-2-oxobutanoyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[4-[(Z)-hex-2-enoyl]oxy-3,3-dimethyl-2-oxobutanoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 156718996 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (2S)-1-[4-[(Z)-hex-2-enoyl]oxy-3,3-dimethyl-2-oxobutanoyl]piperidine-2-carboxylic acid |
| SMILES | CCC/C=C\C(=O)OCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H27NO6/c1-4-5-6-10-14(20)25-12-18(2,3)15(21)16(22)19-11-8-7-9-13(19)17(23)24/h6,10,13H,4-5,7-9,11-12H2,1-3H3,(H,23,24)/b10-6-/t13-/m0/s1 |
| InChIKey | BEHSJHMOSWMFOB-HKBVPSITSA-N |
| XLogP | 1.95 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|