C18H29NO4 — CID 156718902
[2,2-dimethyl-4-(2-methylpiperidin-1-yl)-3,4-dioxobutyl] (Z)-4-methylpent-2-enoate (PubChem CID 156718902) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is [2,2-dimethyl-4-(2-methylpiperidin-1-yl)-3,4-dioxobutyl] (Z)-4-methylpent-2-enoate.
| Compound Name | [2,2-dimethyl-4-(2-methylpiperidin-1-yl)-3,4-dioxobutyl] (Z)-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 156718902 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | [2,2-dimethyl-4-(2-methylpiperidin-1-yl)-3,4-dioxobutyl] (Z)-4-methylpent-2-enoate |
| SMILES | CC(C)/C=C\C(=O)OCC(C)(C)C(=O)C(=O)N1CCCCC1C |
| InChI | InChI=1S/C18H29NO4/c1-13(2)9-10-15(20)23-12-18(4,5)16(21)17(22)19-11-7-6-8-14(19)3/h9-10,13-14H,6-8,11-12H2,1-5H3/b10-9- |
| InChIKey | WJCKVWVGNVUIGH-KTKRTIGZSA-N |
| XLogP | 2.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|