C13H21NO3 — CID 102490545
(3S,4S)-3-hydroxy-3,4-dimethyl-1-piperidin-1-ylhex-5-ene-1,2-dione (PubChem CID 102490545) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (3S,4S)-3-hydroxy-3,4-dimethyl-1-piperidin-1-ylhex-5-ene-1,2-dione.
| Compound Name | (3S,4S)-3-hydroxy-3,4-dimethyl-1-piperidin-1-ylhex-5-ene-1,2-dione |
|---|---|
| PubChem CID | 102490545 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (3S,4S)-3-hydroxy-3,4-dimethyl-1-piperidin-1-ylhex-5-ene-1,2-dione |
| SMILES | C=C[C@H](C)[C@](C)(O)C(=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H21NO3/c1-4-10(2)13(3,17)11(15)12(16)14-8-6-5-7-9-14/h4,10,17H,1,5-9H2,2-3H3/t10-,13-/m0/s1 |
| InChIKey | ORRCTUGNZDOHKC-GWCFXTLKSA-N |
| XLogP | 1.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|