About (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate
(1-cyano-1-hydroxyethyl) piperidine-1-carboxylate (PubChem CID 156636524) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate |
| PubChem CID | 156636524 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate |
| SMILES | CC(O)(C#N)OC(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H14N2O3/c1-9(13,7-10)14-8(12)11-5-3-2-4-6-11/h13H,2-6H2,1H3 |
| InChIKey | XPODTWDDIQKZAK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate?
The IUPAC name of (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate (CID 156636524) is (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate.
What is the SMILES notation for (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate?
The canonical SMILES for (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate is CC(O)(C#N)OC(=O)N1CCCCC1.
What is the InChIKey of (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate?
The InChIKey is XPODTWDDIQKZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-9(13,7-10)14-8(12)11-5-3-2-4-6-11/h13H,2-6H2,1H3.
What are the key properties of (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate?
(1-cyano-1-hydroxyethyl) piperidine-1-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyano-1-hydroxyethyl) piperidine-1-carboxylate is sourced from PubChem (CID 156636524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).