About 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate
2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate (PubChem CID 170530123) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate |
| PubChem CID | 170530123 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate |
| SMILES | CC(C)OC(C)(C)OC(=O)N1CCCCC1 |
| InChI | InChI=1S/C12H23NO3/c1-10(2)15-12(3,4)16-11(14)13-8-6-5-7-9-13/h10H,5-9H2,1-4H3 |
| InChIKey | XGGNJLMCHQAUDB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate?
The IUPAC name of 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate (CID 170530123) is 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate.
What is the SMILES notation for 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate?
The canonical SMILES for 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate is CC(C)OC(C)(C)OC(=O)N1CCCCC1.
What is the InChIKey of 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate?
The InChIKey is XGGNJLMCHQAUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-10(2)15-12(3,4)16-11(14)13-8-6-5-7-9-13/h10H,5-9H2,1-4H3.
What are the key properties of 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate?
2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate has a molecular weight of 229.32 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxypropan-2-yl piperidine-1-carboxylate is sourced from PubChem (CID 170530123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).