C20H30N2O8 — CID 126633310
bis[4-(dimethylamino)-2,2-dimethyl-3,4-dioxobutyl] (E)-but-2-enedioate (PubChem CID 126633310) has the molecular formula C20H30N2O8 and a molecular weight of 426.47 g/mol. Its IUPAC name is bis[4-(dimethylamino)-2,2-dimethyl-3,4-dioxobutyl] (E)-but-2-enedioate.
| Compound Name | bis[4-(dimethylamino)-2,2-dimethyl-3,4-dioxobutyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126633310 |
| Molecular Formula | C20H30N2O8 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | bis[4-(dimethylamino)-2,2-dimethyl-3,4-dioxobutyl] (E)-but-2-enedioate |
| SMILES | CN(C)C(=O)C(=O)C(C)(C)COC(=O)/C=C/C(=O)OCC(C)(C)C(=O)C(=O)N(C)C |
| InChI | InChI=1S/C20H30N2O8/c1-19(2,15(25)17(27)21(5)6)11-29-13(23)9-10-14(24)30-12-20(3,4)16(26)18(28)22(7)8/h9-10H,11-12H2,1-8H3/b10-9+ |
| InChIKey | QTNKEILWZPXXGV-MDZDMXLPSA-N |
| XLogP | -0.00 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|