C21H36N4O3 — CID 126704403
(2S)-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]-3-methyl-2-(propan-2-ylamino)butanamide (PubChem CID 126704403) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2S)-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]-3-methyl-2-(propan-2-ylamino)butanamide.
| Compound Name | (2S)-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]-3-methyl-2-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 126704403 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | (2S)-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]-3-methyl-2-(propan-2-ylamino)butanamide |
| SMILES | CC(C)N[C@H](C(=O)N[C@H]1/C=C/CCNC(=O)/C=C/[C@H](C(C)C)NC1=O)C(C)C |
| InChI | InChI=1S/C21H36N4O3/c1-13(2)16-10-11-18(26)22-12-8-7-9-17(20(27)24-16)25-21(28)19(14(3)4)23-15(5)6/h7,9-11,13-17,19,23H,8,12H2,1-6H3,(H,22,26)(H,24,27)(H,25,28)/b9-7+,11-10+/t16-,17+,19+/m1/s1 |
| InChIKey | WVTHDVWMQMMWPL-FPLKWULMSA-N |
| XLogP | 1.27 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|