C24H29NO11 — CID 126706248
(4S)-4-[[(3E)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethylidene-5-methoxycarbonyl-4H-pyran-2-yl]oxyamino]-5-oxopentanoic acid (PubChem CID 126706248) has the molecular formula C24H29NO11 and a molecular weight of 507.49 g/mol. Its IUPAC name is (4S)-4-[[(3E)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethylidene-5-methoxycarbonyl-4H-pyran-2-yl]oxyamino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(3E)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethylidene-5-methoxycarbonyl-4H-pyran-2-yl]oxyamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 126706248 |
| Molecular Formula | C24H29NO11 |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | (4S)-4-[[(3E)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethylidene-5-methoxycarbonyl-4H-pyran-2-yl]oxyamino]-5-oxopentanoic acid |
| SMILES | C/C=C1/C(ON[C@H](C=O)CCC(=O)O)OC=C(C(=O)OC)C1CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C24H29NO11/c1-3-16-17(11-22(31)34-9-8-14-4-6-19(27)20(28)10-14)18(23(32)33-2)13-35-24(16)36-25-15(12-26)5-7-21(29)30/h3-4,6,10,12-13,15,17,24-25,27-28H,5,7-9,11H2,1-2H3,(H,29,30)/b16-3+/t15-,17?,24?/m0/s1 |
| InChIKey | MSOZDKGTNZPEMO-PLIZNQLTSA-N |
| XLogP | 1.50 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|