C24H29NO11 — CID 126711422
(4S)-4-amino-5-[[4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethenyl-5-methoxycarbonyl-3,4-dihydro-2H-pyran-2-yl]oxy]-5-oxopentanoic acid (PubChem CID 126711422) has the molecular formula C24H29NO11 and a molecular weight of 507.49 g/mol. Its IUPAC name is (4S)-4-amino-5-[[4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethenyl-5-methoxycarbonyl-3,4-dihydro-2H-pyran-2-yl]oxy]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethenyl-5-methoxycarbonyl-3,4-dihydro-2H-pyran-2-yl]oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 126711422 |
| Molecular Formula | C24H29NO11 |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | (4S)-4-amino-5-[[4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-ethenyl-5-methoxycarbonyl-3,4-dihydro-2H-pyran-2-yl]oxy]-5-oxopentanoic acid |
| SMILES | C=CC1C(OC(=O)[C@@H](N)CCC(=O)O)OC=C(C(=O)OC)C1CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C24H29NO11/c1-3-14-15(11-21(30)34-9-8-13-4-6-18(26)19(27)10-13)16(22(31)33-2)12-35-24(14)36-23(32)17(25)5-7-20(28)29/h3-4,6,10,12,14-15,17,24,26-27H,1,5,7-9,11,25H2,2H3,(H,28,29)/t14?,15?,17-,24?/m0/s1 |
| InChIKey | WTTLOZGTPGQUJS-LRYMSKMNSA-N |
| XLogP | 1.14 |
| TPSA | 191.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|