C21H24O10 — CID 102285665
methyl (3S,4S)-2-(acetyloxymethyl)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-formyl-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 102285665) has the molecular formula C21H24O10 and a molecular weight of 436.41 g/mol. Its IUPAC name is methyl (3S,4S)-2-(acetyloxymethyl)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-formyl-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | methyl (3S,4S)-2-(acetyloxymethyl)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-formyl-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 102285665 |
| Molecular Formula | C21H24O10 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methyl (3S,4S)-2-(acetyloxymethyl)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-3-formyl-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | COC(=O)C1=COC(COC(C)=O)[C@@H](C=O)[C@@H]1CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H24O10/c1-12(23)30-11-19-15(9-22)14(16(10-31-19)21(27)28-2)8-20(26)29-6-5-13-3-4-17(24)18(25)7-13/h3-4,7,9-10,14-15,19,24-25H,5-6,8,11H2,1-2H3/t14-,15-,19?/m0/s1 |
| InChIKey | MLSHIXQAAOMUPZ-YIYRCGFGSA-N |
| XLogP | 1.02 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|