C25H32O10 — CID 143749785
methyl (4S,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-6-[(2S,4S,6R)-6-ethyl-4-hydroxyoxan-2-yl]oxy-5-methylidene-4H-pyran-3-carboxylate (PubChem CID 143749785) has the molecular formula C25H32O10 and a molecular weight of 492.52 g/mol. Its IUPAC name is methyl (4S,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-6-[(2S,4S,6R)-6-ethyl-4-hydroxyoxan-2-yl]oxy-5-methylidene-4H-pyran-3-carboxylate.
| Compound Name | methyl (4S,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-6-[(2S,4S,6R)-6-ethyl-4-hydroxyoxan-2-yl]oxy-5-methylidene-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 143749785 |
| Molecular Formula | C25H32O10 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | methyl (4S,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-6-[(2S,4S,6R)-6-ethyl-4-hydroxyoxan-2-yl]oxy-5-methylidene-4H-pyran-3-carboxylate |
| SMILES | C=C1[C@H](O[C@H]2C[C@@H](O)C[C@@H](CC)O2)OC=C(C(=O)OC)[C@H]1CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H32O10/c1-4-17-10-16(26)11-23(34-17)35-25-14(2)18(19(13-33-25)24(30)31-3)12-22(29)32-8-7-15-5-6-20(27)21(28)9-15/h5-6,9,13,16-18,23,25-28H,2,4,7-8,10-12H2,1,3H3/t16-,17+,18-,23-,25-/m0/s1 |
| InChIKey | PVNGJIJKEVZNHX-ZGZNXFSRSA-N |
| XLogP | 2.45 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|