C26H28O11 — CID 124868171
2-(3,4-dihydroxyphenyl)ethyl (4S,4aS,5R,7aS)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-hydroxy-4a,5,7,7a-tetrahydro-4H-furo[3,4-b]pyran-3-carboxylate (PubChem CID 124868171) has the molecular formula C26H28O11 and a molecular weight of 516.50 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethyl (4S,4aS,5R,7aS)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-hydroxy-4a,5,7,7a-tetrahydro-4H-furo[3,4-b]pyran-3-carboxylate.
| Compound Name | 2-(3,4-dihydroxyphenyl)ethyl (4S,4aS,5R,7aS)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-hydroxy-4a,5,7,7a-tetrahydro-4H-furo[3,4-b]pyran-3-carboxylate |
|---|---|
| PubChem CID | 124868171 |
| Molecular Formula | C26H28O11 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethyl (4S,4aS,5R,7aS)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-hydroxy-4a,5,7,7a-tetrahydro-4H-furo[3,4-b]pyran-3-carboxylate |
| SMILES | O=C(C[C@@H]1C(C(=O)OCCc2ccc(O)c(O)c2)=CO[C@@H]2CO[C@@H](O)[C@@H]12)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H28O11/c27-18-3-1-14(9-20(18)29)5-7-34-23(31)11-16-17(12-36-22-13-37-26(33)24(16)22)25(32)35-8-6-15-2-4-19(28)21(30)10-15/h1-4,9-10,12,16,22,24,26-30,33H,5-8,11,13H2/t16-,22-,24+,26-/m1/s1 |
| InChIKey | AIPGFMVNUMXXEM-MATHTASDSA-N |
| XLogP | 1.63 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|