C21H26O7 — CID 58695229
methyl (4S,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-4,6-dimethylpyran-3-carboxylate (PubChem CID 58695229) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is methyl (4S,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-4,6-dimethylpyran-3-carboxylate.
| Compound Name | methyl (4S,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-4,6-dimethylpyran-3-carboxylate |
|---|---|
| PubChem CID | 58695229 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl (4S,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-4,6-dimethylpyran-3-carboxylate |
| SMILES | C/C=C1/[C@H](C)OC=C(C(=O)OC)[C@@]1(C)CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H26O7/c1-5-15-13(2)28-12-16(20(25)26-4)21(15,3)11-19(24)27-9-8-14-6-7-17(22)18(23)10-14/h5-7,10,12-13,22-23H,8-9,11H2,1-4H3/b15-5-/t13-,21-/m0/s1 |
| InChIKey | FOBBGQIJNMIMRR-AXXMNWOZSA-N |
| XLogP | 3.00 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|