C12H14N4S — CID 126708513
2-methyl-7-(5-methyl-1,2,4-triazin-3-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 126708513) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 2-methyl-7-(5-methyl-1,2,4-triazin-3-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-methyl-7-(5-methyl-1,2,4-triazin-3-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 126708513 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-methyl-7-(5-methyl-1,2,4-triazin-3-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | Cc1cnnc(C2CCCc3nc(C)sc32)n1 |
| InChI | InChI=1S/C12H14N4S/c1-7-6-13-16-12(14-7)9-4-3-5-10-11(9)17-8(2)15-10/h6,9H,3-5H2,1-2H3 |
| InChIKey | JJYDUFPNUASTGM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |