C13H18N2S — CID 84588719
N-cyclopent-3-en-1-yl-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 84588719) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | N-cyclopent-3-en-1-yl-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 84588719 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-cyclopent-3-en-1-yl-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | Cc1nc2c(s1)C(NC1CC=CC1)CCC2 |
| InChI | InChI=1S/C13H18N2S/c1-9-14-11-7-4-8-12(13(11)16-9)15-10-5-2-3-6-10/h2-3,10,12,15H,4-8H2,1H3 |
| InChIKey | DFYUMXYXMCLJCL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|