C15H16FN7O — CID 126708947
[6-[(3S)-3-fluoropyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-(pyrimidin-5-ylamino)methanol (PubChem CID 126708947) has the molecular formula C15H16FN7O and a molecular weight of 329.34 g/mol. Its IUPAC name is [6-[(3S)-3-fluoropyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-(pyrimidin-5-ylamino)methanol.
| Compound Name | [6-[(3S)-3-fluoropyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-(pyrimidin-5-ylamino)methanol |
|---|---|
| PubChem CID | 126708947 |
| Molecular Formula | C15H16FN7O |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [6-[(3S)-3-fluoropyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-(pyrimidin-5-ylamino)methanol |
| SMILES | OC(Nc1cncnc1)c1cnc2ccc(N3CC[C@H](F)C3)nn12 |
| InChI | InChI=1S/C15H16FN7O/c16-10-3-4-22(8-10)14-2-1-13-19-7-12(23(13)21-14)15(24)20-11-5-17-9-18-6-11/h1-2,5-7,9-10,15,20,24H,3-4,8H2/t10-,15?/m0/s1 |
| InChIKey | IDSOPSAUIZFQJU-MYHCZTBNSA-N |
| XLogP | 1.17 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|