C15H27N3O2S — CID 126712445
(2S)-N-[(4S,10aS)-7-ethyl-5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanamide (PubChem CID 126712445) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is (2S)-N-[(4S,10aS)-7-ethyl-5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(4S,10aS)-7-ethyl-5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 126712445 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (2S)-N-[(4S,10aS)-7-ethyl-5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanamide |
| SMILES | CCC1CCC[C@@H]2SCC[C@H](NC(=O)[C@H](C)NC)C(=O)N12 |
| InChI | InChI=1S/C15H27N3O2S/c1-4-11-6-5-7-13-18(11)15(20)12(8-9-21-13)17-14(19)10(2)16-3/h10-13,16H,4-9H2,1-3H3,(H,17,19)/t10-,11?,12-,13-/m0/s1 |
| InChIKey | AQGXDVPVFZBRCH-RKLVZMDXSA-N |
| XLogP | 1.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |