C25H33N5O2 — CID 126714327
methyl 2-[4-[1,8-dihydrocyclohepta[d]imidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]butylamino]acetate (PubChem CID 126714327) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is methyl 2-[4-[1,8-dihydrocyclohepta[d]imidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]butylamino]acetate.
| Compound Name | methyl 2-[4-[1,8-dihydrocyclohepta[d]imidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]butylamino]acetate |
|---|---|
| PubChem CID | 126714327 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | methyl 2-[4-[1,8-dihydrocyclohepta[d]imidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]butylamino]acetate |
| SMILES | COC(=O)CNCCCCN(Cc1nc2c([nH]1)CC=CC=C2)C1CCCc2cccnc21 |
| InChI | InChI=1S/C25H33N5O2/c1-32-24(31)17-26-14-5-6-16-30(22-13-7-9-19-10-8-15-27-25(19)22)18-23-28-20-11-3-2-4-12-21(20)29-23/h2-4,8,10-11,15,22,26H,5-7,9,12-14,16-18H2,1H3,(H,28,29) |
| InChIKey | DUZIKEACTVGFGH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|