C21H29NO9 — CID 126720834
benzyl 4-[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxyethoxycarbonyloxy]butanoate (PubChem CID 126720834) has the molecular formula C21H29NO9 and a molecular weight of 439.46 g/mol. Its IUPAC name is benzyl 4-[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxyethoxycarbonyloxy]butanoate.
| Compound Name | benzyl 4-[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxyethoxycarbonyloxy]butanoate |
|---|---|
| PubChem CID | 126720834 |
| Molecular Formula | C21H29NO9 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | benzyl 4-[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxyethoxycarbonyloxy]butanoate |
| SMILES | CC(OC(=O)CNC(=O)OC(C)(C)C)OC(=O)OCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO9/c1-15(29-18(24)13-22-19(25)31-21(2,3)4)30-20(26)27-12-8-11-17(23)28-14-16-9-6-5-7-10-16/h5-7,9-10,15H,8,11-14H2,1-4H3,(H,22,25) |
| InChIKey | QYLHISNPURWHOB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|