C11H9Cl2NO3 — CID 126721192
4-[(2,6-dichlorophenyl)methyl]morpholine-3,5-dione (PubChem CID 126721192) has the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methyl]morpholine-3,5-dione.
| Compound Name | 4-[(2,6-dichlorophenyl)methyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 126721192 |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methyl]morpholine-3,5-dione |
| SMILES | O=C1COCC(=O)N1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H9Cl2NO3/c12-8-2-1-3-9(13)7(8)4-14-10(15)5-17-6-11(14)16/h1-3H,4-6H2 |
| InChIKey | DKDHNXLXKGKJKL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|