C11H9Cl2N — CID 63811760
1-[(2,6-dichlorophenyl)methyl]pyrrole (PubChem CID 63811760) has the molecular formula C11H9Cl2N and a molecular weight of 226.11 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]pyrrole.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]pyrrole |
|---|---|
| PubChem CID | 63811760 |
| Molecular Formula | C11H9Cl2N |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]pyrrole |
| SMILES | Clc1cccc(Cl)c1Cn1cccc1 |
| InChI | InChI=1S/C11H9Cl2N/c12-10-4-3-5-11(13)9(10)8-14-6-1-2-7-14/h1-7H,8H2 |
| InChIKey | NXJONEGUZRUWAW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |