C22H27F7N4O4 — CID 126721893
tert-butyl (2S)-2-[[5-fluoro-6-(3,3,4,4,5,5-hexafluoropiperidin-1-yl)-2-methoxy-3-pyridinyl]methylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 126721893) has the molecular formula C22H27F7N4O4 and a molecular weight of 544.47 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[5-fluoro-6-(3,3,4,4,5,5-hexafluoropiperidin-1-yl)-2-methoxy-3-pyridinyl]methylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[5-fluoro-6-(3,3,4,4,5,5-hexafluoropiperidin-1-yl)-2-methoxy-3-pyridinyl]methylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126721893 |
| Molecular Formula | C22H27F7N4O4 |
| Molecular Weight | 544.47 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | tert-butyl (2S)-2-[[5-fluoro-6-(3,3,4,4,5,5-hexafluoropiperidin-1-yl)-2-methoxy-3-pyridinyl]methylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COc1nc(N2CC(F)(F)C(F)(F)C(F)(F)C2)c(F)cc1CNC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27F7N4O4/c1-19(2,3)37-18(35)33-7-5-6-14(33)16(34)30-9-12-8-13(23)15(31-17(12)36-4)32-10-20(24,25)22(28,29)21(26,27)11-32/h8,14H,5-7,9-11H2,1-4H3,(H,30,34)/t14-/m0/s1 |
| InChIKey | CSMGFIROLRYJPV-AWEZNQCLSA-N |
| XLogP | 3.97 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|