C21H28FN5O3 — CID 126724731
(E)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-3-fluoro-2-(methylideneamino)-4-methylimino-4-(oxetan-3-ylamino)but-2-enamide (PubChem CID 126724731) has the molecular formula C21H28FN5O3 and a molecular weight of 417.49 g/mol. Its IUPAC name is (E)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-3-fluoro-2-(methylideneamino)-4-methylimino-4-(oxetan-3-ylamino)but-2-enamide.
| Compound Name | (E)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-3-fluoro-2-(methylideneamino)-4-methylimino-4-(oxetan-3-ylamino)but-2-enamide |
|---|---|
| PubChem CID | 126724731 |
| Molecular Formula | C21H28FN5O3 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (E)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-3-fluoro-2-(methylideneamino)-4-methylimino-4-(oxetan-3-ylamino)but-2-enamide |
| SMILES | C=N/C(C(=O)NC[C@H](O)CN1CCc2ccccc2C1)=C(F)\C(=N\C)NC1COC1 |
| InChI | InChI=1S/C21H28FN5O3/c1-23-19(18(22)20(24-2)26-16-12-30-13-16)21(29)25-9-17(28)11-27-8-7-14-5-3-4-6-15(14)10-27/h3-6,16-17,28H,1,7-13H2,2H3,(H,24,26)(H,25,29)/b19-18+/t17-/m0/s1 |
| InChIKey | RSVAJYBMLVQLTI-SISFKGJESA-N |
| XLogP | 0.42 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|