C19H22N2O2 — CID 126724734
4-[2-(3-amino-2-hydroxypropyl)-3,4-dihydro-1H-isoquinolin-7-yl]benzaldehyde (PubChem CID 126724734) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[2-(3-amino-2-hydroxypropyl)-3,4-dihydro-1H-isoquinolin-7-yl]benzaldehyde.
| Compound Name | 4-[2-(3-amino-2-hydroxypropyl)-3,4-dihydro-1H-isoquinolin-7-yl]benzaldehyde |
|---|---|
| PubChem CID | 126724734 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-[2-(3-amino-2-hydroxypropyl)-3,4-dihydro-1H-isoquinolin-7-yl]benzaldehyde |
| SMILES | NCC(O)CN1CCc2ccc(-c3ccc(C=O)cc3)cc2C1 |
| InChI | InChI=1S/C19H22N2O2/c20-10-19(23)12-21-8-7-16-5-6-17(9-18(16)11-21)15-3-1-14(13-22)2-4-15/h1-6,9,13,19,23H,7-8,10-12,20H2 |
| InChIKey | OWKPHDRVJXJPQY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|