C11H13NO — CID 84717608
2-ethyl-1,3-dihydroisoindole-5-carbaldehyde (PubChem CID 84717608) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-ethyl-1,3-dihydroisoindole-5-carbaldehyde.
| Compound Name | 2-ethyl-1,3-dihydroisoindole-5-carbaldehyde |
|---|---|
| PubChem CID | 84717608 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-ethyl-1,3-dihydroisoindole-5-carbaldehyde |
| SMILES | CCN1Cc2ccc(C=O)cc2C1 |
| InChI | InChI=1S/C11H13NO/c1-2-12-6-10-4-3-9(8-13)5-11(10)7-12/h3-5,8H,2,6-7H2,1H3 |
| InChIKey | JYFYTNFODQVWRV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|