2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride

C10H12ClNO2S — CID 84802969

IUPAC2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride
SMILESCCN1Cc2ccc(S(=O)(=O)Cl)cc2C1
InChIInChI=1S/C10H12ClNO2S/c1-2-12-6-8-3-4-10(15(11,13)14)5-9(8)7-12/h3-5H,2,6-7H2,1H3
InChIKeyKCUAYJKMQUAQQN-UHFFFAOYSA-N
MW245.73 g/mol
LogP1.95
Rot. Bonds2

About 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride

2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride (PubChem CID 84802969) has the molecular formula C10H12ClNO2S and a molecular weight of 245.73 g/mol. Its IUPAC name is 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride.

Molecular Properties

Compound Name2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride
PubChem CID84802969
Molecular FormulaC10H12ClNO2S
Molecular Weight245.73 g/mol
Exact Mass245.03
IUPAC Name2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride
SMILESCCN1Cc2ccc(S(=O)(=O)Cl)cc2C1
InChIInChI=1S/C10H12ClNO2S/c1-2-12-6-8-3-4-10(15(11,13)14)5-9(8)7-12/h3-5H,2,6-7H2,1H3
InChIKeyKCUAYJKMQUAQQN-UHFFFAOYSA-N
XLogP1.95
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.73
LogP ≤ 51.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride?
The IUPAC name of 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride (CID 84802969) is 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride.
What is the SMILES notation for 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride?
The canonical SMILES for 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride is CCN1Cc2ccc(S(=O)(=O)Cl)cc2C1.
What is the InChIKey of 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride?
The InChIKey is KCUAYJKMQUAQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO2S/c1-2-12-6-8-3-4-10(15(11,13)14)5-9(8)7-12/h3-5H,2,6-7H2,1H3.
What are the key properties of 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride?
2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride has a molecular weight of 245.73 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3-dihydroisoindole-5-sulfonyl chloride is sourced from PubChem (CID 84802969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).