C10H12ClNO2S — CID 84705466
1,2-dimethyl-2,3-dihydroindole-5-sulfonyl chloride (PubChem CID 84705466) has the molecular formula C10H12ClNO2S and a molecular weight of 245.73 g/mol. Its IUPAC name is 1,2-dimethyl-2,3-dihydroindole-5-sulfonyl chloride.
| Compound Name | 1,2-dimethyl-2,3-dihydroindole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 84705466 |
| Molecular Formula | C10H12ClNO2S |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 1,2-dimethyl-2,3-dihydroindole-5-sulfonyl chloride |
| SMILES | CC1Cc2cc(S(=O)(=O)Cl)ccc2N1C |
| InChI | InChI=1S/C10H12ClNO2S/c1-7-5-8-6-9(15(11,13)14)3-4-10(8)12(7)2/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | KVMQPDYOHICDEL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |