C23H34F2O2 — CID 126727581
1-ethenyl-4-[4-[[(1Z,3Z)-4-ethoxy-2,3-difluorohexa-1,3,5-trienoxy]methyl]cyclohexyl]cyclohexane (PubChem CID 126727581) has the molecular formula C23H34F2O2 and a molecular weight of 380.52 g/mol. Its IUPAC name is 1-ethenyl-4-[4-[[(1Z,3Z)-4-ethoxy-2,3-difluorohexa-1,3,5-trienoxy]methyl]cyclohexyl]cyclohexane.
| Compound Name | 1-ethenyl-4-[4-[[(1Z,3Z)-4-ethoxy-2,3-difluorohexa-1,3,5-trienoxy]methyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 126727581 |
| Molecular Formula | C23H34F2O2 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 1-ethenyl-4-[4-[[(1Z,3Z)-4-ethoxy-2,3-difluorohexa-1,3,5-trienoxy]methyl]cyclohexyl]cyclohexane |
| SMILES | C=C/C(OCC)=C(F)\C(F)=C\OCC1CCC(C2CCC(C=C)CC2)CC1 |
| InChI | InChI=1S/C23H34F2O2/c1-4-17-7-11-19(12-8-17)20-13-9-18(10-14-20)15-26-16-21(24)23(25)22(5-2)27-6-3/h4-5,16-20H,1-2,6-15H2,3H3/b21-16-,23-22- |
| InChIKey | MNCFOZLUCQGMFY-DMBQCRFLSA-N |
| XLogP | 7.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|