C20H33N — CID 126729033
N-[(2Z,4E,6Z)-4-ethylidene-5-methylnona-2,6-dien-5-yl]-4,4-dimethylcyclohex-2-en-1-amine (PubChem CID 126729033) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is N-[(2Z,4E,6Z)-4-ethylidene-5-methylnona-2,6-dien-5-yl]-4,4-dimethylcyclohex-2-en-1-amine.
| Compound Name | N-[(2Z,4E,6Z)-4-ethylidene-5-methylnona-2,6-dien-5-yl]-4,4-dimethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 126729033 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N-[(2Z,4E,6Z)-4-ethylidene-5-methylnona-2,6-dien-5-yl]-4,4-dimethylcyclohex-2-en-1-amine |
| SMILES | C/C=C\C(=C/C)C(C)(/C=C\CC)NC1C=CC(C)(C)CC1 |
| InChI | InChI=1S/C20H33N/c1-7-10-14-20(6,17(9-3)11-8-2)21-18-12-15-19(4,5)16-13-18/h8-12,14-15,18,21H,7,13,16H2,1-6H3/b11-8-,14-10-,17-9+ |
| InChIKey | UHZRASLOYWJFKG-LPRQFHRUSA-N |
| XLogP | 5.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|