C20H26N2O3 — CID 126729132
(5S,9R)-9-methyl-3-phenacyl-6-propan-2-yl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 126729132) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (5S,9R)-9-methyl-3-phenacyl-6-propan-2-yl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,9R)-9-methyl-3-phenacyl-6-propan-2-yl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 126729132 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (5S,9R)-9-methyl-3-phenacyl-6-propan-2-yl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)C1CC[C@@H](C)C[C@]12NC(=O)N(CC(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C20H26N2O3/c1-13(2)16-10-9-14(3)11-20(16)18(24)22(19(25)21-20)12-17(23)15-7-5-4-6-8-15/h4-8,13-14,16H,9-12H2,1-3H3,(H,21,25)/t14-,16?,20+/m1/s1 |
| InChIKey | KIBFWEQMFFTPJR-WWUFKLEJSA-N |
| XLogP | 3.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|