C20H25BrN2O6 — CID 126729706
ethyl 5-bromo-3-[ethoxycarbonyl-[(2S)-2-ethyloxan-4-yl]amino]furo[2,3-c]pyridine-2-carboxylate (PubChem CID 126729706) has the molecular formula C20H25BrN2O6 and a molecular weight of 469.33 g/mol. Its IUPAC name is ethyl 5-bromo-3-[ethoxycarbonyl-[(2S)-2-ethyloxan-4-yl]amino]furo[2,3-c]pyridine-2-carboxylate.
| Compound Name | ethyl 5-bromo-3-[ethoxycarbonyl-[(2S)-2-ethyloxan-4-yl]amino]furo[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 126729706 |
| Molecular Formula | C20H25BrN2O6 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | ethyl 5-bromo-3-[ethoxycarbonyl-[(2S)-2-ethyloxan-4-yl]amino]furo[2,3-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1oc2cnc(Br)cc2c1N(C(=O)OCC)C1CCO[C@@H](CC)C1 |
| InChI | InChI=1S/C20H25BrN2O6/c1-4-13-9-12(7-8-28-13)23(20(25)27-6-3)17-14-10-16(21)22-11-15(14)29-18(17)19(24)26-5-2/h10-13H,4-9H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | YFFOHCGHMUUZQX-ABLWVSNPSA-N |
| XLogP | 4.69 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|