C11H21NO3 — CID 126729772
ethyl N-[(2S,4S)-2-ethyloxan-4-yl]-N-methylcarbamate (PubChem CID 126729772) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is ethyl N-[(2S,4S)-2-ethyloxan-4-yl]-N-methylcarbamate.
| Compound Name | ethyl N-[(2S,4S)-2-ethyloxan-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 126729772 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | ethyl N-[(2S,4S)-2-ethyloxan-4-yl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)[C@H]1CCO[C@@H](CC)C1 |
| InChI | InChI=1S/C11H21NO3/c1-4-10-8-9(6-7-15-10)12(3)11(13)14-5-2/h9-10H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | GYPMHQTUMQIHDK-UWVGGRQHSA-N |
| XLogP | 2.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |