C5H11N3 — CID 126731686
(1E,3Z)-2-(aminomethyl)buta-1,3-diene-1,4-diamine (PubChem CID 126731686) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is (1E,3Z)-2-(aminomethyl)buta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-2-(aminomethyl)buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 126731686 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | (1E,3Z)-2-(aminomethyl)buta-1,3-diene-1,4-diamine |
| SMILES | N/C=C\C(=C/N)CN |
| InChI | InChI=1S/C5H11N3/c6-2-1-5(3-7)4-8/h1-3H,4,6-8H2/b2-1-,5-3+ |
| InChIKey | XEXUOHNSVBZCEL-REDYYMJGSA-N |
| XLogP | -0.74 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|