C7H14N2 — CID 59966833
(1Z,3Z)-2-propan-2-ylbuta-1,3-diene-1,4-diamine (PubChem CID 59966833) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (1Z,3Z)-2-propan-2-ylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-2-propan-2-ylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 59966833 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1Z,3Z)-2-propan-2-ylbuta-1,3-diene-1,4-diamine |
| SMILES | CC(C)C(/C=C\N)=C/N |
| InChI | InChI=1S/C7H14N2/c1-6(2)7(5-9)3-4-8/h3-6H,8-9H2,1-2H3/b4-3-,7-5+ |
| InChIKey | PWUARVMYCBVZPQ-QVXLNCAUSA-N |
| XLogP | 0.96 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|