C11H14IN — CID 126732375
(3R)-3-ethyl-2-iodo-3,4-dihydro-1H-isoquinoline (PubChem CID 126732375) has the molecular formula C11H14IN and a molecular weight of 287.14 g/mol. Its IUPAC name is (3R)-3-ethyl-2-iodo-3,4-dihydro-1H-isoquinoline.
| Compound Name | (3R)-3-ethyl-2-iodo-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 126732375 |
| Molecular Formula | C11H14IN |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (3R)-3-ethyl-2-iodo-3,4-dihydro-1H-isoquinoline |
| SMILES | CC[C@@H]1Cc2ccccc2CN1I |
| InChI | InChI=1S/C11H14IN/c1-2-11-7-9-5-3-4-6-10(9)8-13(11)12/h3-6,11H,2,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | QFICNLULRKSZGJ-LLVKDONJSA-N |
| XLogP | 3.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|