C11H15NS — CID 20699474
(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methanethiol (PubChem CID 20699474) has the molecular formula C11H15NS and a molecular weight of 193.32 g/mol. Its IUPAC name is (2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methanethiol.
| Compound Name | (2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methanethiol |
|---|---|
| PubChem CID | 20699474 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.32 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methanethiol |
| SMILES | CN1Cc2ccccc2CC1CS |
| InChI | InChI=1S/C11H15NS/c1-12-7-10-5-3-2-4-9(10)6-11(12)8-13/h2-5,11,13H,6-8H2,1H3 |
| InChIKey | MJAYNXOYEXEUCM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|