About ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline
ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline (PubChem CID 177193029) has the molecular formula C17H31N
and a molecular weight of 249.44 g/mol. Its IUPAC name is ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 177193029 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline |
| SMILES | CC.CC.CC(C)C1Cc2ccccc2CN1C |
| InChI | InChI=1S/C13H19N.2C2H6/c1-10(2)13-8-11-6-4-5-7-12(11)9-14(13)3;2*1-2/h4-7,10,13H,8-9H2,1-3H3;2*1-2H3 |
| InChIKey | NHEYPXPFFMIWQG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline (CID 177193029) is ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline is CC.CC.CC(C)C1Cc2ccccc2CN1C.
What is the InChIKey of ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline?
The InChIKey is NHEYPXPFFMIWQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N.2C2H6/c1-10(2)13-8-11-6-4-5-7-12(11)9-14(13)3;2*1-2/h4-7,10,13H,8-9H2,1-3H3;2*1-2H3.
What are the key properties of ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline?
ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline has a molecular weight of 249.44 g/mol, XLogP of 4.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-3-propan-2-yl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 177193029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).